C10H17N — CID 170151755
(3aS,6aS)-3a-methylspiro[1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,1'-cyclopropane] (PubChem CID 170151755) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (3aS,6aS)-3a-methylspiro[1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,1'-cyclopropane].
| Compound Name | (3aS,6aS)-3a-methylspiro[1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,1'-cyclopropane] |
|---|---|
| PubChem CID | 170151755 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (3aS,6aS)-3a-methylspiro[1,2,3,5,6,6a-hexahydrocyclopenta[c]pyrrole-4,1'-cyclopropane] |
| SMILES | C[C@]12CNC[C@H]1CCC21CC1 |
| InChI | InChI=1S/C10H17N/c1-9-7-11-6-8(9)2-3-10(9)4-5-10/h8,11H,2-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | FKVJNQOMELECOX-BDAKNGLRSA-N |
| XLogP | 1.79 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |