C21H33N5O5 — CID 170151841
methyl 2-[1-[4-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)butyl]piperidin-4-yl]acetate (PubChem CID 170151841) has the molecular formula C21H33N5O5 and a molecular weight of 435.53 g/mol. Its IUPAC name is methyl 2-[1-[4-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)butyl]piperidin-4-yl]acetate.
| Compound Name | methyl 2-[1-[4-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)butyl]piperidin-4-yl]acetate |
|---|---|
| PubChem CID | 170151841 |
| Molecular Formula | C21H33N5O5 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | methyl 2-[1-[4-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)butyl]piperidin-4-yl]acetate |
| SMILES | CCCCOc1nc2c([nH]c(=O)n2CCCCN2CCC(CC(=O)OC)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C21H33N5O5/c1-3-4-13-31-20-23-18-17(19(28)24-20)22-21(29)26(18)10-6-5-9-25-11-7-15(8-12-25)14-16(27)30-2/h15H,3-14H2,1-2H3,(H,22,29)(H,23,24,28) |
| InChIKey | WQBOYXXMXMTKDB-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|