C18H27N5O5 — CID 170151843
1-[3-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)propyl]piperidine-4-carboxylic acid (PubChem CID 170151843) has the molecular formula C18H27N5O5 and a molecular weight of 393.44 g/mol. Its IUPAC name is 1-[3-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)propyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[3-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)propyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 170151843 |
| Molecular Formula | C18H27N5O5 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | 1-[3-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)propyl]piperidine-4-carboxylic acid |
| SMILES | CCCCOc1nc2c([nH]c(=O)n2CCCN2CCC(C(=O)O)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H27N5O5/c1-2-3-11-28-17-20-14-13(15(24)21-17)19-18(27)23(14)8-4-7-22-9-5-12(6-10-22)16(25)26/h12H,2-11H2,1H3,(H,19,27)(H,25,26)(H,20,21,24) |
| InChIKey | WZRIRUHLVRHUSV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|