C21H33N5O5 — CID 170151883
1-[6-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)hexyl]piperidine-4-carboxylic acid (PubChem CID 170151883) has the molecular formula C21H33N5O5 and a molecular weight of 435.53 g/mol. Its IUPAC name is 1-[6-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)hexyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[6-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)hexyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 170151883 |
| Molecular Formula | C21H33N5O5 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.25 |
| IUPAC Name | 1-[6-(2-butoxy-6,8-dioxo-1,7-dihydropurin-9-yl)hexyl]piperidine-4-carboxylic acid |
| SMILES | CCCCOc1nc2c([nH]c(=O)n2CCCCCCN2CCC(C(=O)O)CC2)c(=O)[nH]1 |
| InChI | InChI=1S/C21H33N5O5/c1-2-3-14-31-20-23-17-16(18(27)24-20)22-21(30)26(17)11-7-5-4-6-10-25-12-8-15(9-13-25)19(28)29/h15H,2-14H2,1H3,(H,22,30)(H,28,29)(H,23,24,27) |
| InChIKey | GJQXPARCANSZPL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|