C31H29N3 — CID 170152624
2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-2-azatricyclo[3.3.1.13,7]decane (PubChem CID 170152624) has the molecular formula C31H29N3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-2-azatricyclo[3.3.1.13,7]decane.
| Compound Name | 2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-2-azatricyclo[3.3.1.13,7]decane |
|---|---|
| PubChem CID | 170152624 |
| Molecular Formula | C31H29N3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 2-[4-(4,6-diphenylpyrimidin-2-yl)phenyl]-2-azatricyclo[3.3.1.13,7]decane |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(N4C5CC6CC(C5)CC4C6)cc3)n2)cc1 |
| InChI | InChI=1S/C31H29N3/c1-3-7-23(8-4-1)29-20-30(24-9-5-2-6-10-24)33-31(32-29)25-11-13-26(14-12-25)34-27-16-21-15-22(18-27)19-28(34)17-21/h1-14,20-22,27-28H,15-19H2 |
| InChIKey | ARZSOUCNPFQEPP-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |