C23H26N5OP — CID 170152700
[2-[(1Z)-1-(ethylideneamino)buta-1,3-dienyl]-3-pyridinyl]-[4-[(3-ethynylpyrazol-1-yl)methyl]-4-phosphanylpiperidin-1-yl]methanone (PubChem CID 170152700) has the molecular formula C23H26N5OP and a molecular weight of 419.47 g/mol. Its IUPAC name is [2-[(1Z)-1-(ethylideneamino)buta-1,3-dienyl]-3-pyridinyl]-[4-[(3-ethynylpyrazol-1-yl)methyl]-4-phosphanylpiperidin-1-yl]methanone.
| Compound Name | [2-[(1Z)-1-(ethylideneamino)buta-1,3-dienyl]-3-pyridinyl]-[4-[(3-ethynylpyrazol-1-yl)methyl]-4-phosphanylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 170152700 |
| Molecular Formula | C23H26N5OP |
| Molecular Weight | 419.47 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | [2-[(1Z)-1-(ethylideneamino)buta-1,3-dienyl]-3-pyridinyl]-[4-[(3-ethynylpyrazol-1-yl)methyl]-4-phosphanylpiperidin-1-yl]methanone |
| SMILES | C#Cc1ccn(CC2(P)CCN(C(=O)c3cccnc3C(=C/C=C)/N=C/C)CC2)n1 |
| InChI | InChI=1S/C23H26N5OP/c1-4-8-20(24-6-3)21-19(9-7-13-25-21)22(29)27-15-11-23(30,12-16-27)17-28-14-10-18(5-2)26-28/h2,4,6-10,13-14H,1,11-12,15-17,30H2,3H3/b20-8-,24-6+ |
| InChIKey | BJROXCXPCXGABL-JICDXQKSSA-N |
| XLogP | 3.43 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|