C11H17FO2 — CID 170152721
(1R,4aS,7S,7aR)-7-ethyl-3-fluoro-4-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol (PubChem CID 170152721) has the molecular formula C11H17FO2 and a molecular weight of 200.25 g/mol. Its IUPAC name is (1R,4aS,7S,7aR)-7-ethyl-3-fluoro-4-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol.
| Compound Name | (1R,4aS,7S,7aR)-7-ethyl-3-fluoro-4-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol |
|---|---|
| PubChem CID | 170152721 |
| Molecular Formula | C11H17FO2 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (1R,4aS,7S,7aR)-7-ethyl-3-fluoro-4-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-1-ol |
| SMILES | CC[C@H]1CC[C@@H]2C(C)=C(F)O[C@@H](O)[C@H]12 |
| InChI | InChI=1S/C11H17FO2/c1-3-7-4-5-8-6(2)10(12)14-11(13)9(7)8/h7-9,11,13H,3-5H2,1-2H3/t7-,8+,9+,11+/m0/s1 |
| InChIKey | SHFHUBAZLGDLHF-YSSBGUOXSA-N |
| XLogP | 2.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |