About (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone
(5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone (PubChem CID 170153111) has the molecular formula C18H15N3O2
and a molecular weight of 305.34 g/mol. Its IUPAC name is (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone.
Molecular Properties
| Compound Name | (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone |
| PubChem CID | 170153111 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone |
| SMILES | NC1=Cc2cc(C(=O)c3cc4cc(O)ccc4[nH]3)[nH]c2C=CC1 |
| InChI | InChI=1S/C18H15N3O2/c19-12-2-1-3-14-10(6-12)8-16(20-14)18(23)17-9-11-7-13(22)4-5-15(11)21-17/h1,3-9,20-22H,2,19H2 |
| InChIKey | WQHYRHNPLPJYIP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 94.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone?
The IUPAC name of (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone (CID 170153111) is (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone.
What is the SMILES notation for (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone?
The canonical SMILES for (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone is NC1=Cc2cc(C(=O)c3cc4cc(O)ccc4[nH]3)[nH]c2C=CC1.
What is the InChIKey of (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone?
The InChIKey is WQHYRHNPLPJYIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3O2/c19-12-2-1-3-14-10(6-12)8-16(20-14)18(23)17-9-11-7-13(22)4-5-15(11)21-17/h1,3-9,20-22H,2,19H2.
What are the key properties of (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone?
(5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone has a molecular weight of 305.34 g/mol, XLogP of 3.15, 2 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-amino-1,6-dihydrocyclohepta[b]pyrrol-2-yl)-(5-hydroxy-1H-indol-2-yl)methanone is sourced from PubChem (CID 170153111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).