C27H27N2+ — CID 170153519
9-[4-(1-azoniatricyclo[3.3.1.13,7]decan-1-yl)phenyl]carbazole (PubChem CID 170153519) has the molecular formula C27H27N2+ and a molecular weight of 379.53 g/mol. Its IUPAC name is 9-[4-(1-azoniatricyclo[3.3.1.13,7]decan-1-yl)phenyl]carbazole.
| Compound Name | 9-[4-(1-azoniatricyclo[3.3.1.13,7]decan-1-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 170153519 |
| Molecular Formula | C27H27N2+ |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | 9-[4-(1-azoniatricyclo[3.3.1.13,7]decan-1-yl)phenyl]carbazole |
| SMILES | c1ccc2c(c1)c1ccccc1n2-c1ccc([N+]23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C27H27N2/c1-3-7-26-24(5-1)25-6-2-4-8-27(25)28(26)22-9-11-23(12-10-22)29-16-19-13-20(17-29)15-21(14-19)18-29/h1-12,19-21H,13-18H2/q+1 |
| InChIKey | VJHKBHCCHIHKBX-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|