About 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal
2-(1-hydroxyethyl)-3,5,5-trimethylhexanal (PubChem CID 170153803) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal.
Molecular Properties
| Compound Name | 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal |
| PubChem CID | 170153803 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal |
| SMILES | CC(O)C(C=O)C(C)CC(C)(C)C |
| InChI | InChI=1S/C11H22O2/c1-8(6-11(3,4)5)10(7-12)9(2)13/h7-10,13H,6H2,1-5H3 |
| InChIKey | CLAPGKVFWLGULU-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal?
The IUPAC name of 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal (CID 170153803) is 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal.
What is the SMILES notation for 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal?
The canonical SMILES for 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal is CC(O)C(C=O)C(C)CC(C)(C)C.
What is the InChIKey of 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal?
The InChIKey is CLAPGKVFWLGULU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-8(6-11(3,4)5)10(7-12)9(2)13/h7-10,13H,6H2,1-5H3.
What are the key properties of 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal?
2-(1-hydroxyethyl)-3,5,5-trimethylhexanal has a molecular weight of 186.29 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-hydroxyethyl)-3,5,5-trimethylhexanal is sourced from PubChem (CID 170153803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).