About 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine
3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine (PubChem CID 170154282) has the molecular formula C14H27FN2O
and a molecular weight of 258.38 g/mol. Its IUPAC name is 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine.
Molecular Properties
| Compound Name | 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine |
| PubChem CID | 170154282 |
| Molecular Formula | C14H27FN2O |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine |
| SMILES | CC(C)NC1CC(OCCC(C)N[C@@H]2C[C@@H]2F)C1 |
| InChI | InChI=1S/C14H27FN2O/c1-9(2)16-11-6-12(7-11)18-5-4-10(3)17-14-8-13(14)15/h9-14,16-17H,4-8H2,1-3H3/t10?,11?,12?,13-,14+/m0/s1 |
| InChIKey | BBDRDZSEIINHED-OTRKIEDLSA-N |
| XLogP | 2.01 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine?
The IUPAC name of 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine (CID 170154282) is 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine.
What is the SMILES notation for 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine?
The canonical SMILES for 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine is CC(C)NC1CC(OCCC(C)N[C@@H]2C[C@@H]2F)C1.
What is the InChIKey of 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine?
The InChIKey is BBDRDZSEIINHED-OTRKIEDLSA-N. The full InChI is InChI=1S/C14H27FN2O/c1-9(2)16-11-6-12(7-11)18-5-4-10(3)17-14-8-13(14)15/h9-14,16-17H,4-8H2,1-3H3/t10?,11?,12?,13-,14+/m0/s1.
What are the key properties of 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine?
3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine has a molecular weight of 258.38 g/mol, XLogP of 2.01, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[[(1R,2S)-2-fluorocyclopropyl]amino]butoxy]-N-propan-2-ylcyclobutan-1-amine is sourced from PubChem (CID 170154282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).