C17H18Cl2N4O3 — CID 170154654
[1-(2,4-dichlorophenyl)pyrazol-3-yl] (Z,1Z)-N-methoxy-3-methyl-5-(methylamino)-5-oxopent-2-enimidate (PubChem CID 170154654) has the molecular formula C17H18Cl2N4O3 and a molecular weight of 397.26 g/mol. Its IUPAC name is [1-(2,4-dichlorophenyl)pyrazol-3-yl] (Z,1Z)-N-methoxy-3-methyl-5-(methylamino)-5-oxopent-2-enimidate.
| Compound Name | [1-(2,4-dichlorophenyl)pyrazol-3-yl] (Z,1Z)-N-methoxy-3-methyl-5-(methylamino)-5-oxopent-2-enimidate |
|---|---|
| PubChem CID | 170154654 |
| Molecular Formula | C17H18Cl2N4O3 |
| Molecular Weight | 397.26 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [1-(2,4-dichlorophenyl)pyrazol-3-yl] (Z,1Z)-N-methoxy-3-methyl-5-(methylamino)-5-oxopent-2-enimidate |
| SMILES | CNC(=O)C/C(C)=C\C(=N\OC)Oc1ccn(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C17H18Cl2N4O3/c1-11(8-15(24)20-2)9-17(22-25-3)26-16-6-7-23(21-16)14-5-4-12(18)10-13(14)19/h4-7,9-10H,8H2,1-3H3,(H,20,24)/b11-9-,22-17- |
| InChIKey | VGWQRZJLRYJZMI-PCJWLMPMSA-N |
| XLogP | 3.60 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.26 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|