About methanol;spiro[3.3]heptane
methanol;spiro[3.3]heptane (PubChem CID 170155109) has the molecular formula C8H16O
and a molecular weight of 128.22 g/mol. Its IUPAC name is methanol;spiro[3.3]heptane.
Molecular Properties
| Compound Name | methanol;spiro[3.3]heptane |
| PubChem CID | 170155109 |
| Molecular Formula | C8H16O |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.12 |
| IUPAC Name | methanol;spiro[3.3]heptane |
| SMILES | C1CC2(C1)CCC2.CO |
| InChI | InChI=1S/C7H12.CH4O/c1-3-7(4-1)5-2-6-7;1-2/h1-6H2;2H,1H3 |
| InChIKey | JACVYMUYLFNMGK-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methanol;spiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;spiro[3.3]heptane?
The IUPAC name of methanol;spiro[3.3]heptane (CID 170155109) is methanol;spiro[3.3]heptane.
What is the SMILES notation for methanol;spiro[3.3]heptane?
The canonical SMILES for methanol;spiro[3.3]heptane is C1CC2(C1)CCC2.CO.
What is the InChIKey of methanol;spiro[3.3]heptane?
The InChIKey is JACVYMUYLFNMGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12.CH4O/c1-3-7(4-1)5-2-6-7;1-2/h1-6H2;2H,1H3.
What are the key properties of methanol;spiro[3.3]heptane?
methanol;spiro[3.3]heptane has a molecular weight of 128.22 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;spiro[3.3]heptane is sourced from PubChem (CID 170155109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).