About (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid
(2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid (PubChem CID 170155915) has the molecular formula C12H16N4O4
and a molecular weight of 280.28 g/mol. Its IUPAC name is (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid.
Molecular Properties
| Compound Name | (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid |
| PubChem CID | 170155915 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid |
| SMILES | C[C@@H]1CN(c2ccc([N+](=O)[O-])cn2)[C@H](C)CN1C(=O)O |
| InChI | InChI=1S/C12H16N4O4/c1-8-7-15(12(17)18)9(2)6-14(8)11-4-3-10(5-13-11)16(19)20/h3-5,8-9H,6-7H2,1-2H3,(H,17,18)/t8-,9-/m1/s1 |
| InChIKey | MFJQDPREDJUVQI-RKDXNWHRSA-N |
| XLogP | 1.57 |
| TPSA | 99.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid?
The IUPAC name of (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid (CID 170155915) is (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid.
What is the SMILES notation for (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid?
The canonical SMILES for (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid is C[C@@H]1CN(c2ccc([N+](=O)[O-])cn2)[C@H](C)CN1C(=O)O.
What is the InChIKey of (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid?
The InChIKey is MFJQDPREDJUVQI-RKDXNWHRSA-N. The full InChI is InChI=1S/C12H16N4O4/c1-8-7-15(12(17)18)9(2)6-14(8)11-4-3-10(5-13-11)16(19)20/h3-5,8-9H,6-7H2,1-2H3,(H,17,18)/t8-,9-/m1/s1.
What are the key properties of (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid?
(2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid has a molecular weight of 280.28 g/mol, XLogP of 1.57, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2,5-dimethyl-4-(5-nitro-2-pyridinyl)piperazine-1-carboxylic acid is sourced from PubChem (CID 170155915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).