About 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid
6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid (PubChem CID 170157193) has the molecular formula C9H17N3O3
and a molecular weight of 215.25 g/mol. Its IUPAC name is 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid.
Molecular Properties
| Compound Name | 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid |
| PubChem CID | 170157193 |
| Molecular Formula | C9H17N3O3 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid |
| SMILES | COCC1CNCC2(CN(C(=O)O)C2)N1 |
| InChI | InChI=1S/C9H17N3O3/c1-15-3-7-2-10-4-9(11-7)5-12(6-9)8(13)14/h7,10-11H,2-6H2,1H3,(H,13,14) |
| InChIKey | QTTKKYBTQMKZFO-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid?
The IUPAC name of 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid (CID 170157193) is 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid.
What is the SMILES notation for 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid?
The canonical SMILES for 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid is COCC1CNCC2(CN(C(=O)O)C2)N1.
What is the InChIKey of 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid?
The InChIKey is QTTKKYBTQMKZFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O3/c1-15-3-7-2-10-4-9(11-7)5-12(6-9)8(13)14/h7,10-11H,2-6H2,1H3,(H,13,14).
What are the key properties of 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid?
6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid has a molecular weight of 215.25 g/mol, XLogP of -1.07, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methoxymethyl)-2,5,8-triazaspiro[3.5]nonane-2-carboxylic acid is sourced from PubChem (CID 170157193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).