C13H18BrNO3 — CID 170157678
(3-bromo-2-methoxyphenyl)methyl N-tert-butylcarbamate (PubChem CID 170157678) has the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. Its IUPAC name is (3-bromo-2-methoxyphenyl)methyl N-tert-butylcarbamate.
| Compound Name | (3-bromo-2-methoxyphenyl)methyl N-tert-butylcarbamate |
|---|---|
| PubChem CID | 170157678 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | (3-bromo-2-methoxyphenyl)methyl N-tert-butylcarbamate |
| SMILES | COc1c(Br)cccc1COC(=O)NC(C)(C)C |
| InChI | InChI=1S/C13H18BrNO3/c1-13(2,3)15-12(16)18-8-9-6-5-7-10(14)11(9)17-4/h5-7H,8H2,1-4H3,(H,15,16) |
| InChIKey | XZRUNBNBTPYWRE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |