C21H23F3N4O4 — CID 170157721
2-[6-(3,5-dimethylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)-4,5,7-trifluoro-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde (PubChem CID 170157721) has the molecular formula C21H23F3N4O4 and a molecular weight of 452.43 g/mol. Its IUPAC name is 2-[6-(3,5-dimethylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)-4,5,7-trifluoro-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[6-(3,5-dimethylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)-4,5,7-trifluoro-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 170157721 |
| Molecular Formula | C21H23F3N4O4 |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 2-[6-(3,5-dimethylpiperazin-1-yl)-2-(2,6-dioxopiperidin-3-yl)-4,5,7-trifluoro-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde |
| SMILES | CC1CN(c2c(F)c(F)c3c(c2F)C(C(=O)C=O)N(C2CCC(=O)NC2=O)C3)CC(C)N1 |
| InChI | InChI=1S/C21H23F3N4O4/c1-9-5-27(6-10(2)25-9)20-17(23)15-11(16(22)18(20)24)7-28(19(15)13(30)8-29)12-3-4-14(31)26-21(12)32/h8-10,12,19,25H,3-7H2,1-2H3,(H,26,31,32) |
| InChIKey | KNTIWKAOUBWFRT-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|