C20H22F2N4O3 — CID 170157823
2-[5-[7-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-4,6-difluoro-3-oxo-1H-isoindol-2-yl]piperidin-2-yl]-2-oxoacetaldehyde (PubChem CID 170157823) has the molecular formula C20H22F2N4O3 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-[5-[7-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-4,6-difluoro-3-oxo-1H-isoindol-2-yl]piperidin-2-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[5-[7-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-4,6-difluoro-3-oxo-1H-isoindol-2-yl]piperidin-2-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 170157823 |
| Molecular Formula | C20H22F2N4O3 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 2-[5-[7-(3,6-diazabicyclo[3.1.1]heptan-3-yl)-4,6-difluoro-3-oxo-1H-isoindol-2-yl]piperidin-2-yl]-2-oxoacetaldehyde |
| SMILES | O=CC(=O)C1CCC(N2Cc3c(c(F)cc(F)c3N3CC4CC(C3)N4)C2=O)CN1 |
| InChI | InChI=1S/C20H22F2N4O3/c21-14-4-15(22)19(25-6-10-3-11(7-25)24-10)13-8-26(20(29)18(13)14)12-1-2-16(23-5-12)17(28)9-27/h4,9-12,16,23-24H,1-3,5-8H2 |
| InChIKey | BNJZLZIKOIAVQX-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|