C20H17N3O3 — CID 170159723
3-(4-cyanophenyl)-3-[(7-methyl-1H-indole-2-carbonyl)amino]propanoic acid (PubChem CID 170159723) has the molecular formula C20H17N3O3 and a molecular weight of 347.37 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-3-[(7-methyl-1H-indole-2-carbonyl)amino]propanoic acid.
| Compound Name | 3-(4-cyanophenyl)-3-[(7-methyl-1H-indole-2-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 170159723 |
| Molecular Formula | C20H17N3O3 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 3-(4-cyanophenyl)-3-[(7-methyl-1H-indole-2-carbonyl)amino]propanoic acid |
| SMILES | Cc1cccc2cc(C(=O)NC(CC(=O)O)c3ccc(C#N)cc3)[nH]c12 |
| InChI | InChI=1S/C20H17N3O3/c1-12-3-2-4-15-9-17(22-19(12)15)20(26)23-16(10-18(24)25)14-7-5-13(11-21)6-8-14/h2-9,16,22H,10H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | DMMXJEYVLPYKEF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 105.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |