About (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid
(3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid (PubChem CID 170159879) has the molecular formula C5H7N7O2
and a molecular weight of 197.16 g/mol. Its IUPAC name is (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid.
Molecular Properties
| Compound Name | (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid |
| PubChem CID | 170159879 |
| Molecular Formula | C5H7N7O2 |
| Molecular Weight | 197.16 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid |
| SMILES | [N-]=[N+]=N[C@H]1CN(C(=O)O)C[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C5H7N7O2/c6-10-8-3-1-12(5(13)14)2-4(3)9-11-7/h3-4H,1-2H2,(H,13,14)/t3-,4+ |
| InChIKey | MDMXKWABLRCEQS-ZXZARUISSA-N |
| XLogP | 1.34 |
| TPSA | 138.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.16 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid?
The IUPAC name of (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid (CID 170159879) is (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid.
What is the SMILES notation for (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid?
The canonical SMILES for (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid is [N-]=[N+]=N[C@H]1CN(C(=O)O)C[C@H]1N=[N+]=[N-].
What is the InChIKey of (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid?
The InChIKey is MDMXKWABLRCEQS-ZXZARUISSA-N. The full InChI is InChI=1S/C5H7N7O2/c6-10-8-3-1-12(5(13)14)2-4(3)9-11-7/h3-4H,1-2H2,(H,13,14)/t3-,4+.
What are the key properties of (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid?
(3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid has a molecular weight of 197.16 g/mol, XLogP of 1.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,4R)-3,4-diazidopyrrolidine-1-carboxylic acid is sourced from PubChem (CID 170159879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).