C24H24F4N2O2 — CID 170160396
5-(3,5-difluorophenyl)-1'-(2,2-difluoro-2-phenylethyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one (PubChem CID 170160396) has the molecular formula C24H24F4N2O2 and a molecular weight of 448.46 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-1'-(2,2-difluoro-2-phenylethyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one.
| Compound Name | 5-(3,5-difluorophenyl)-1'-(2,2-difluoro-2-phenylethyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
|---|---|
| PubChem CID | 170160396 |
| Molecular Formula | C24H24F4N2O2 |
| Molecular Weight | 448.46 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 5-(3,5-difluorophenyl)-1'-(2,2-difluoro-2-phenylethyl)spiro[5,6,7,7a-tetrahydropyrrolo[2,1-b][1,3]oxazole-2,4'-piperidine]-3-one |
| SMILES | O=C1N2C(CCC2c2cc(F)cc(F)c2)OC12CCN(CC(F)(F)c1ccccc1)CC2 |
| InChI | InChI=1S/C24H24F4N2O2/c25-18-12-16(13-19(26)14-18)20-6-7-21-30(20)22(31)23(32-21)8-10-29(11-9-23)15-24(27,28)17-4-2-1-3-5-17/h1-5,12-14,20-21H,6-11,15H2 |
| InChIKey | PGKUDSIOPOLLIQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.46 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |