About [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate
[3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate (PubChem CID 170160525) has the molecular formula C9H14F3NO3S
and a molecular weight of 273.28 g/mol. Its IUPAC name is [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate |
| PubChem CID | 170160525 |
| Molecular Formula | C9H14F3NO3S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)S(=O)CC1CN(OC(=O)C(F)(F)F)C1 |
| InChI | InChI=1S/C9H14F3NO3S/c1-6(2)17(15)5-7-3-13(4-7)16-8(14)9(10,11)12/h6-7H,3-5H2,1-2H3 |
| InChIKey | NUVPRDXIXTYJRZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate?
The IUPAC name of [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate (CID 170160525) is [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate.
What is the SMILES notation for [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate?
The canonical SMILES for [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate is CC(C)S(=O)CC1CN(OC(=O)C(F)(F)F)C1.
What is the InChIKey of [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate?
The InChIKey is NUVPRDXIXTYJRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO3S/c1-6(2)17(15)5-7-3-13(4-7)16-8(14)9(10,11)12/h6-7H,3-5H2,1-2H3.
What are the key properties of [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate?
[3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate has a molecular weight of 273.28 g/mol, XLogP of 1.10, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(propan-2-ylsulfinylmethyl)azetidin-1-yl] 2,2,2-trifluoroacetate is sourced from PubChem (CID 170160525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).