About 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene
1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene (PubChem CID 170160671) has the molecular formula C21H27Br
and a molecular weight of 359.35 g/mol. Its IUPAC name is 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene.
Molecular Properties
| Compound Name | 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene |
| PubChem CID | 170160671 |
| Molecular Formula | C21H27Br |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene |
| SMILES | Cc1cccc(Br)c1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H27Br/c1-14-9-8-10-18(22)19(14)15-11-16(20(2,3)4)13-17(12-15)21(5,6)7/h8-13H,1-7H3 |
| InChIKey | XNHZLCAZKDOXIX-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene?
The IUPAC name of 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene (CID 170160671) is 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene.
What is the SMILES notation for 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene?
The canonical SMILES for 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene is Cc1cccc(Br)c1-c1cc(C(C)(C)C)cc(C(C)(C)C)c1.
What is the InChIKey of 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene?
The InChIKey is XNHZLCAZKDOXIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27Br/c1-14-9-8-10-18(22)19(14)15-11-16(20(2,3)4)13-17(12-15)21(5,6)7/h8-13H,1-7H3.
What are the key properties of 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene?
1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene has a molecular weight of 359.35 g/mol, XLogP of 7.02, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-(3,5-ditert-butylphenyl)-3-methylbenzene is sourced from PubChem (CID 170160671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).