C15H16F6N6S — CID 170162210
6-(6-methylsulfanyl-2-pyridinyl)-2-N,4-N-bis(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 170162210) has the molecular formula C15H16F6N6S and a molecular weight of 426.39 g/mol. Its IUPAC name is 6-(6-methylsulfanyl-2-pyridinyl)-2-N,4-N-bis(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(6-methylsulfanyl-2-pyridinyl)-2-N,4-N-bis(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 170162210 |
| Molecular Formula | C15H16F6N6S |
| Molecular Weight | 426.39 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | 6-(6-methylsulfanyl-2-pyridinyl)-2-N,4-N-bis(1,1,1-trifluoropropan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CSc1cccc(-c2nc(NC(C)C(F)(F)F)nc(NC(C)C(F)(F)F)n2)n1 |
| InChI | InChI=1S/C15H16F6N6S/c1-7(14(16,17)18)22-12-25-11(9-5-4-6-10(24-9)28-3)26-13(27-12)23-8(2)15(19,20)21/h4-8H,1-3H3,(H2,22,23,25,26,27) |
| InChIKey | KUNRVODWGULPIF-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |