About 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile
5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile (PubChem CID 170163156) has the molecular formula C11H11BrN2
and a molecular weight of 251.13 g/mol. Its IUPAC name is 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile.
Molecular Properties
| Compound Name | 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile |
| PubChem CID | 170163156 |
| Molecular Formula | C11H11BrN2 |
| Molecular Weight | 251.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile |
| SMILES | CC1(C)c2cc(Br)ccc2NC1C#N |
| InChI | InChI=1S/C11H11BrN2/c1-11(2)8-5-7(12)3-4-9(8)14-10(11)6-13/h3-5,10,14H,1-2H3 |
| InChIKey | JYWKXOSMILNXEX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.13 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile?
The IUPAC name of 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile (CID 170163156) is 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile.
What is the SMILES notation for 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile?
The canonical SMILES for 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile is CC1(C)c2cc(Br)ccc2NC1C#N.
What is the InChIKey of 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile?
The InChIKey is JYWKXOSMILNXEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrN2/c1-11(2)8-5-7(12)3-4-9(8)14-10(11)6-13/h3-5,10,14H,1-2H3.
What are the key properties of 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile?
5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile has a molecular weight of 251.13 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3,3-dimethyl-1,2-dihydroindole-2-carbonitrile is sourced from PubChem (CID 170163156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).