About 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid
1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid (PubChem CID 170163995) has the molecular formula C14H17N5O4
and a molecular weight of 319.32 g/mol. Its IUPAC name is 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid |
| PubChem CID | 170163995 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid |
| SMILES | O=C1CCN(c2cnc(N3CCC(C(=O)O)CC3)nc2)C(=O)N1 |
| InChI | InChI=1S/C14H17N5O4/c20-11-3-6-19(14(23)17-11)10-7-15-13(16-8-10)18-4-1-9(2-5-18)12(21)22/h7-9H,1-6H2,(H,21,22)(H,17,20,23) |
| InChIKey | FJTODMYMEDQFNH-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid?
The IUPAC name of 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid (CID 170163995) is 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid?
The canonical SMILES for 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid is O=C1CCN(c2cnc(N3CCC(C(=O)O)CC3)nc2)C(=O)N1.
What is the InChIKey of 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid?
The InChIKey is FJTODMYMEDQFNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O4/c20-11-3-6-19(14(23)17-11)10-7-15-13(16-8-10)18-4-1-9(2-5-18)12(21)22/h7-9H,1-6H2,(H,21,22)(H,17,20,23).
What are the key properties of 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid?
1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid has a molecular weight of 319.32 g/mol, XLogP of 0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,4-dioxo-1,3-diazinan-1-yl)pyrimidin-2-yl]piperidine-4-carboxylic acid is sourced from PubChem (CID 170163995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).