About 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide
2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide (PubChem CID 170166121) has the molecular formula C9H11N5O3
and a molecular weight of 237.22 g/mol. Its IUPAC name is 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide.
Molecular Properties
| Compound Name | 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide |
| PubChem CID | 170166121 |
| Molecular Formula | C9H11N5O3 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide |
| SMILES | NC(=O)C(N)CC1Oc2ncncc2NC1=O |
| InChI | InChI=1S/C9H11N5O3/c10-4(7(11)15)1-6-8(16)14-5-2-12-3-13-9(5)17-6/h2-4,6H,1,10H2,(H2,11,15)(H,14,16) |
| InChIKey | VGYMJBIDMOAQBC-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide?
The IUPAC name of 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide (CID 170166121) is 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide.
What is the SMILES notation for 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide?
The canonical SMILES for 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide is NC(=O)C(N)CC1Oc2ncncc2NC1=O.
What is the InChIKey of 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide?
The InChIKey is VGYMJBIDMOAQBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O3/c10-4(7(11)15)1-6-8(16)14-5-2-12-3-13-9(5)17-6/h2-4,6H,1,10H2,(H2,11,15)(H,14,16).
What are the key properties of 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide?
2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide has a molecular weight of 237.22 g/mol, XLogP of -1.62, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(6-oxo-5H-pyrimido[4,5-b][1,4]oxazin-7-yl)propanamide is sourced from PubChem (CID 170166121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).