C22H29F3N6O4 — CID 170166591
(1R,2S,5S)-N-(2-amino-2-oxo-1-pyridazin-3-ylethyl)-3-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide (PubChem CID 170166591) has the molecular formula C22H29F3N6O4 and a molecular weight of 498.51 g/mol. Its IUPAC name is (1R,2S,5S)-N-(2-amino-2-oxo-1-pyridazin-3-ylethyl)-3-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide.
| Compound Name | (1R,2S,5S)-N-(2-amino-2-oxo-1-pyridazin-3-ylethyl)-3-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
|---|---|
| PubChem CID | 170166591 |
| Molecular Formula | C22H29F3N6O4 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (1R,2S,5S)-N-(2-amino-2-oxo-1-pyridazin-3-ylethyl)-3-[3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanoyl]-6,6-dimethyl-3-azabicyclo[3.1.0]hexane-2-carboxamide |
| SMILES | CC(C)(C)C(NC(=O)C(F)(F)F)C(=O)N1C[C@H]2[C@@H]([C@H]1C(=O)NC(C(N)=O)c1cccnn1)C2(C)C |
| InChI | InChI=1S/C22H29F3N6O4/c1-20(2,3)15(29-19(35)22(23,24)25)18(34)31-9-10-12(21(10,4)5)14(31)17(33)28-13(16(26)32)11-7-6-8-27-30-11/h6-8,10,12-15H,9H2,1-5H3,(H2,26,32)(H,28,33)(H,29,35)/t10-,12-,13?,14-,15?/m0/s1 |
| InChIKey | JHEMWZZVNPSSPT-KPZIJZHKSA-N |
| XLogP | 0.70 |
| TPSA | 147.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |