C27H10Br2F26O — CID 170167920
1,3-bis[4-bromo-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]propan-2-one (PubChem CID 170167920) has the molecular formula C27H10Br2F26O and a molecular weight of 1004.13 g/mol. Its IUPAC name is 1,3-bis[4-bromo-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]propan-2-one.
| Compound Name | 1,3-bis[4-bromo-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 170167920 |
| Molecular Formula | C27H10Br2F26O |
| Molecular Weight | 1004.13 g/mol |
| Exact Mass | 1001.87 |
| IUPAC Name | 1,3-bis[4-bromo-2-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexyl)phenyl]propan-2-one |
| SMILES | O=C(Cc1ccc(Br)cc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)Cc1ccc(Br)cc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C27H10Br2F26O/c28-11-3-1-9(14(7-11)16(30,31)18(34,35)20(38,39)22(42,43)24(46,47)26(50,51)52)5-13(56)6-10-2-4-12(29)8-15(10)17(32,33)19(36,37)21(40,41)23(44,45)25(48,49)27(53,54)55/h1-4,7-8H,5-6H2 |
| InChIKey | LTIKYLXBNMKVPK-UHFFFAOYSA-N |
| XLogP | 12.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.13 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|