C58H54Cl2F2N10O8 — CID 170168176
6-chloro-7-(2-fluoro-6-hydroxyphenyl)-1-[2-(1-hydroxyethyl)phenyl]-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one (PubChem CID 170168176) has the molecular formula C58H54Cl2F2N10O8 and a molecular weight of 1128.03 g/mol. Its IUPAC name is 6-chloro-7-(2-fluoro-6-hydroxyphenyl)-1-[2-(1-hydroxyethyl)phenyl]-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one.
| Compound Name | 6-chloro-7-(2-fluoro-6-hydroxyphenyl)-1-[2-(1-hydroxyethyl)phenyl]-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 170168176 |
| Molecular Formula | C58H54Cl2F2N10O8 |
| Molecular Weight | 1128.03 g/mol |
| Exact Mass | 1126.35 |
| IUPAC Name | 6-chloro-7-(2-fluoro-6-hydroxyphenyl)-1-[2-(1-hydroxyethyl)phenyl]-4-[(2S)-2-methyl-4-prop-2-enoylpiperazin-1-yl]pyrido[2,3-d]pyrimidin-2-one |
| SMILES | C=CC(=O)N1CCN(c2nc(=O)n(-c3ccccc3C(C)O)c3nc(-c4c(O)cccc4F)c(Cl)cc23)[C@@H](C)C1.C=CC(=O)N1CCN(c2nc(=O)n(-c3ccccc3C(C)O)c3nc(-c4c(O)cccc4F)c(Cl)cc23)[C@@H](C)C1 |
| InChI | InChI=1S/2C29H27ClFN5O4/c2*1-4-24(39)34-12-13-35(16(2)15-34)27-19-14-20(30)26(25-21(31)9-7-11-23(25)38)32-28(19)36(29(40)33-27)22-10-6-5-8-18(22)17(3)37/h2*4-11,14,16-17,37-38H,1,12-13,15H2,2-3H3/t2*16-,17?/m00/s1 |
| InChIKey | XBMFFEZEXSZRCT-KKJDXMKOSA-N |
| XLogP | 8.44 |
| TPSA | 223.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 80 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1128.03 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|