C14H22O3 — CID 170168629
carbonic acid;2-cyclohex-2-en-1-ylbicyclo[2.2.1]heptane (PubChem CID 170168629) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is carbonic acid;2-cyclohex-2-en-1-ylbicyclo[2.2.1]heptane.
| Compound Name | carbonic acid;2-cyclohex-2-en-1-ylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 170168629 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | carbonic acid;2-cyclohex-2-en-1-ylbicyclo[2.2.1]heptane |
| SMILES | C1=CC(C2CC3CCC2C3)CCC1.O=C(O)O |
| InChI | InChI=1S/C13H20.CH2O3/c1-2-4-11(5-3-1)13-9-10-6-7-12(13)8-10;2-1(3)4/h2,4,10-13H,1,3,5-9H2;(H2,2,3,4) |
| InChIKey | BDNWLVXEMVQHSW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|