C14H13Cl2F3N2O2 — CID 170170092
6,7-dichloro-1-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;2,2,2-trifluoroacetic acid (PubChem CID 170170092) has the molecular formula C14H13Cl2F3N2O2 and a molecular weight of 369.17 g/mol. Its IUPAC name is 6,7-dichloro-1-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;2,2,2-trifluoroacetic acid.
| Compound Name | 6,7-dichloro-1-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 170170092 |
| Molecular Formula | C14H13Cl2F3N2O2 |
| Molecular Weight | 369.17 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | 6,7-dichloro-1-methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;2,2,2-trifluoroacetic acid |
| SMILES | CC1NCCc2[nH]c3c(Cl)c(Cl)ccc3c21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C12H12Cl2N2.C2HF3O2/c1-6-10-7-2-3-8(13)11(14)12(7)16-9(10)4-5-15-6;3-2(4,5)1(6)7/h2-3,6,15-16H,4-5H2,1H3;(H,6,7) |
| InChIKey | PUHGCEBVAKVKKQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.17 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|