C19H20ClF4N3O5 — CID 170170148
propan-2-yl 3-[2-chloro-4-fluoro-5-[hydroxy-[(Z)-4,4,4-trifluoro-3-(methylamino)but-2-enoyl]amino]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxylate (PubChem CID 170170148) has the molecular formula C19H20ClF4N3O5 and a molecular weight of 481.83 g/mol. Its IUPAC name is propan-2-yl 3-[2-chloro-4-fluoro-5-[hydroxy-[(Z)-4,4,4-trifluoro-3-(methylamino)but-2-enoyl]amino]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxylate.
| Compound Name | propan-2-yl 3-[2-chloro-4-fluoro-5-[hydroxy-[(Z)-4,4,4-trifluoro-3-(methylamino)but-2-enoyl]amino]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 170170148 |
| Molecular Formula | C19H20ClF4N3O5 |
| Molecular Weight | 481.83 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | propan-2-yl 3-[2-chloro-4-fluoro-5-[hydroxy-[(Z)-4,4,4-trifluoro-3-(methylamino)but-2-enoyl]amino]phenyl]-5-methyl-4H-1,2-oxazole-5-carboxylate |
| SMILES | CN/C(=C\C(=O)N(O)c1cc(C2=NOC(C)(C(=O)OC(C)C)C2)c(Cl)cc1F)C(F)(F)F |
| InChI | InChI=1S/C19H20ClF4N3O5/c1-9(2)31-17(29)18(3)8-13(26-32-18)10-5-14(12(21)6-11(10)20)27(30)16(28)7-15(25-4)19(22,23)24/h5-7,9,25,30H,8H2,1-4H3/b15-7- |
| InChIKey | HRWQMYJYYODADG-CHHVJCJISA-N |
| XLogP | 3.70 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|