About 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid
2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid (PubChem CID 170170288) has the molecular formula C11H14BrF2N3O5S
and a molecular weight of 418.22 g/mol. Its IUPAC name is 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid.
Molecular Properties
| Compound Name | 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid |
| PubChem CID | 170170288 |
| Molecular Formula | C11H14BrF2N3O5S |
| Molecular Weight | 418.22 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid |
| SMILES | CS(=O)(=O)Nc1cc(Br)cnc1OCCN(CC(F)F)C(=O)O |
| InChI | InChI=1S/C11H14BrF2N3O5S/c1-23(20,21)16-8-4-7(12)5-15-10(8)22-3-2-17(11(18)19)6-9(13)14/h4-5,9,16H,2-3,6H2,1H3,(H,18,19) |
| InChIKey | LYEGREUGRCSYNF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid?
The IUPAC name of 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid (CID 170170288) is 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid.
What is the SMILES notation for 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid?
The canonical SMILES for 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid is CS(=O)(=O)Nc1cc(Br)cnc1OCCN(CC(F)F)C(=O)O.
What is the InChIKey of 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid?
The InChIKey is LYEGREUGRCSYNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14BrF2N3O5S/c1-23(20,21)16-8-4-7(12)5-15-10(8)22-3-2-17(11(18)19)6-9(13)14/h4-5,9,16H,2-3,6H2,1H3,(H,18,19).
What are the key properties of 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid?
2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid has a molecular weight of 418.22 g/mol, XLogP of 1.84, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5-bromo-3-(methanesulfonamido)-2-pyridinyl]oxy]ethyl-(2,2-difluoroethyl)carbamic acid is sourced from PubChem (CID 170170288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).