C11H12Cl2N2O4S — CID 170170514
6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;sulfuric acid (PubChem CID 170170514) has the molecular formula C11H12Cl2N2O4S and a molecular weight of 339.20 g/mol. Its IUPAC name is 6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;sulfuric acid.
| Compound Name | 6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;sulfuric acid |
|---|---|
| PubChem CID | 170170514 |
| Molecular Formula | C11H12Cl2N2O4S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 6,7-dichloro-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole;sulfuric acid |
| SMILES | Clc1ccc2c3c([nH]c2c1Cl)CCNC3.O=S(=O)(O)O |
| InChI | InChI=1S/C11H10Cl2N2.H2O4S/c12-8-2-1-6-7-5-14-4-3-9(7)15-11(6)10(8)13;1-5(2,3)4/h1-2,14-15H,3-5H2;(H2,1,2,3,4) |
| InChIKey | IPFWZFDLHWCWDU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|