C23H19ClF2N4O4 — CID 170170913
[3-chloro-5-cyano-2-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-4-methylphenyl] carbamate (PubChem CID 170170913) has the molecular formula C23H19ClF2N4O4 and a molecular weight of 488.88 g/mol. Its IUPAC name is [3-chloro-5-cyano-2-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-4-methylphenyl] carbamate.
| Compound Name | [3-chloro-5-cyano-2-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-4-methylphenyl] carbamate |
|---|---|
| PubChem CID | 170170913 |
| Molecular Formula | C23H19ClF2N4O4 |
| Molecular Weight | 488.88 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | [3-chloro-5-cyano-2-[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-4-methylphenyl] carbamate |
| SMILES | Cc1c(C#N)cc(OC(N)=O)c(C2CN(c3cc(F)c(C4CCC(=O)NC4=O)c(F)c3)C2)c1Cl |
| InChI | InChI=1S/C23H19ClF2N4O4/c1-10-11(7-27)4-17(34-23(28)33)19(21(10)24)12-8-30(9-12)13-5-15(25)20(16(26)6-13)14-2-3-18(31)29-22(14)32/h4-6,12,14H,2-3,8-9H2,1H3,(H2,28,33)(H,29,31,32) |
| InChIKey | ISUIMZDRSFPPLE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.88 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|