C28H53NO5S2 — CID 170170964
6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)hexane-1-sulfonic acid;6-methyl-N-(6-methylheptyl)heptan-1-amine (PubChem CID 170170964) has the molecular formula C28H53NO5S2 and a molecular weight of 547.87 g/mol. Its IUPAC name is 6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)hexane-1-sulfonic acid;6-methyl-N-(6-methylheptyl)heptan-1-amine.
| Compound Name | 6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)hexane-1-sulfonic acid;6-methyl-N-(6-methylheptyl)heptan-1-amine |
|---|---|
| PubChem CID | 170170964 |
| Molecular Formula | C28H53NO5S2 |
| Molecular Weight | 547.87 g/mol |
| Exact Mass | 547.34 |
| IUPAC Name | 6-(2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)hexane-1-sulfonic acid;6-methyl-N-(6-methylheptyl)heptan-1-amine |
| SMILES | CC(C)CCCCCNCCCCCC(C)C.O=S(=O)(O)CCCCCCC1COc2cscc2O1 |
| InChI | InChI=1S/C16H35N.C12H18O5S2/c1-15(2)11-7-5-9-13-17-14-10-6-8-12-16(3)4;13-19(14,15)6-4-2-1-3-5-10-7-16-11-8-18-9-12(11)17-10/h15-17H,5-14H2,1-4H3;8-10H,1-7H2,(H,13,14,15) |
| InChIKey | SSXGCCQNWSQNCJ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.87 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|