About 3-anilino-3-(1,3-thiazol-2-yl)butanamide
3-anilino-3-(1,3-thiazol-2-yl)butanamide (PubChem CID 170171365) has the molecular formula C13H15N3OS
and a molecular weight of 261.35 g/mol. Its IUPAC name is 3-anilino-3-(1,3-thiazol-2-yl)butanamide.
Molecular Properties
| Compound Name | 3-anilino-3-(1,3-thiazol-2-yl)butanamide |
| PubChem CID | 170171365 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 3-anilino-3-(1,3-thiazol-2-yl)butanamide |
| SMILES | CC(CC(N)=O)(Nc1ccccc1)c1nccs1 |
| InChI | InChI=1S/C13H15N3OS/c1-13(9-11(14)17,12-15-7-8-18-12)16-10-5-3-2-4-6-10/h2-8,16H,9H2,1H3,(H2,14,17) |
| InChIKey | BKZSDDVVTXMJKO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-anilino-3-(1,3-thiazol-2-yl)butanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilino-3-(1,3-thiazol-2-yl)butanamide?
The IUPAC name of 3-anilino-3-(1,3-thiazol-2-yl)butanamide (CID 170171365) is 3-anilino-3-(1,3-thiazol-2-yl)butanamide.
What is the SMILES notation for 3-anilino-3-(1,3-thiazol-2-yl)butanamide?
The canonical SMILES for 3-anilino-3-(1,3-thiazol-2-yl)butanamide is CC(CC(N)=O)(Nc1ccccc1)c1nccs1.
What is the InChIKey of 3-anilino-3-(1,3-thiazol-2-yl)butanamide?
The InChIKey is BKZSDDVVTXMJKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3OS/c1-13(9-11(14)17,12-15-7-8-18-12)16-10-5-3-2-4-6-10/h2-8,16H,9H2,1H3,(H2,14,17).
What are the key properties of 3-anilino-3-(1,3-thiazol-2-yl)butanamide?
3-anilino-3-(1,3-thiazol-2-yl)butanamide has a molecular weight of 261.35 g/mol, XLogP of 2.35, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilino-3-(1,3-thiazol-2-yl)butanamide is sourced from PubChem (CID 170171365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).