C8H12F3N3O — CID 170172113
4-amino-5,5,5-trifluoro-4-(1H-pyrazol-5-yl)pentan-1-ol (PubChem CID 170172113) has the molecular formula C8H12F3N3O and a molecular weight of 223.20 g/mol. Its IUPAC name is 4-amino-5,5,5-trifluoro-4-(1H-pyrazol-5-yl)pentan-1-ol.
| Compound Name | 4-amino-5,5,5-trifluoro-4-(1H-pyrazol-5-yl)pentan-1-ol |
|---|---|
| PubChem CID | 170172113 |
| Molecular Formula | C8H12F3N3O |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 4-amino-5,5,5-trifluoro-4-(1H-pyrazol-5-yl)pentan-1-ol |
| SMILES | NC(CCCO)(c1ccn[nH]1)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N3O/c9-8(10,11)7(12,3-1-5-15)6-2-4-13-14-6/h2,4,15H,1,3,5,12H2,(H,13,14) |
| InChIKey | MWCYAFZSYAPXBM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 74.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |