C22H24F3N5O2S3 — CID 170172218
8-[[(1R,5S)-3-[5-methyl-2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methylsulfonyl]-7,8λ4-dithia-9-azabicyclo[4.3.0]nona-1,3,5,8-tetraene (PubChem CID 170172218) has the molecular formula C22H24F3N5O2S3 and a molecular weight of 543.66 g/mol. Its IUPAC name is 8-[[(1R,5S)-3-[5-methyl-2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methylsulfonyl]-7,8λ4-dithia-9-azabicyclo[4.3.0]nona-1,3,5,8-tetraene.
| Compound Name | 8-[[(1R,5S)-3-[5-methyl-2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methylsulfonyl]-7,8λ4-dithia-9-azabicyclo[4.3.0]nona-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 170172218 |
| Molecular Formula | C22H24F3N5O2S3 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | 8-[[(1R,5S)-3-[5-methyl-2-[(2S)-2-methylazetidin-1-yl]-6-(trifluoromethyl)pyrimidin-4-yl]-3-azabicyclo[3.1.0]hexan-6-yl]methylsulfonyl]-7,8λ4-dithia-9-azabicyclo[4.3.0]nona-1,3,5,8-tetraene |
| SMILES | Cc1c(N2C[C@@H]3C(CS(=O)(=O)S4=Nc5ccccc5S4)[C@@H]3C2)nc(N2CC[C@@H]2C)nc1C(F)(F)F |
| InChI | InChI=1S/C22H24F3N5O2S3/c1-12-7-8-30(12)21-26-19(22(23,24)25)13(2)20(27-21)29-9-14-15(10-29)16(14)11-35(31,32)34-28-17-5-3-4-6-18(17)33-34/h3-6,12,14-16H,7-11H2,1-2H3/t12-,14-,15+,16?,34?/m0/s1 |
| InChIKey | WLZRJAZWTISBIK-BOSAQYBZSA-N |
| XLogP | 4.57 |
| TPSA | 78.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|