C26H49NO5 — CID 170172557
(2S,4S)-4-hydroxy-1-(6-oxo-6-pentadecan-7-yloxyhexyl)pyrrolidine-2-carboxylic acid (PubChem CID 170172557) has the molecular formula C26H49NO5 and a molecular weight of 455.68 g/mol. Its IUPAC name is (2S,4S)-4-hydroxy-1-(6-oxo-6-pentadecan-7-yloxyhexyl)pyrrolidine-2-carboxylic acid.
| Compound Name | (2S,4S)-4-hydroxy-1-(6-oxo-6-pentadecan-7-yloxyhexyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 170172557 |
| Molecular Formula | C26H49NO5 |
| Molecular Weight | 455.68 g/mol |
| Exact Mass | 455.36 |
| IUPAC Name | (2S,4S)-4-hydroxy-1-(6-oxo-6-pentadecan-7-yloxyhexyl)pyrrolidine-2-carboxylic acid |
| SMILES | CCCCCCCCC(CCCCCC)OC(=O)CCCCCN1C[C@@H](O)C[C@H]1C(=O)O |
| InChI | InChI=1S/C26H49NO5/c1-3-5-7-9-10-13-17-23(16-12-8-6-4-2)32-25(29)18-14-11-15-19-27-21-22(28)20-24(27)26(30)31/h22-24,28H,3-21H2,1-2H3,(H,30,31)/t22-,23?,24-/m0/s1 |
| InChIKey | DCDBBZGFVPZBFT-OTKIHZFJSA-N |
| XLogP | 5.70 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|