About (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid
(3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid (PubChem CID 170172706) has the molecular formula C33H35NO9
and a molecular weight of 589.64 g/mol. Its IUPAC name is (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid.
Molecular Properties
| Compound Name | (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid |
| PubChem CID | 170172706 |
| Molecular Formula | C33H35NO9 |
| Molecular Weight | 589.64 g/mol |
| Exact Mass | 589.23 |
| IUPAC Name | (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid |
| SMILES | C[C@@H]1CN(Cc2ccccc2)CCC1=O.Cc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H18O8.C13H17NO/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14;1-11-9-14(8-7-13(11)15)10-12-5-3-2-4-6-12/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);2-6,11H,7-10H2,1H3/t;11-/m.1/s1 |
| InChIKey | GZARIRGTYYIPBB-HVZQFPCNSA-N |
| XLogP | 4.32 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 589.64 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid?
The IUPAC name of (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid (CID 170172706) is (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid.
What is the SMILES notation for (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid?
The canonical SMILES for (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid is C[C@@H]1CN(Cc2ccccc2)CCC1=O.Cc1ccc(C(=O)OC(C(=O)O)C(OC(=O)c2ccc(C)cc2)C(=O)O)cc1.
What is the InChIKey of (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid?
The InChIKey is GZARIRGTYYIPBB-HVZQFPCNSA-N. The full InChI is InChI=1S/C20H18O8.C13H17NO/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14;1-11-9-14(8-7-13(11)15)10-12-5-3-2-4-6-12/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);2-6,11H,7-10H2,1H3/t;11-/m.1/s1.
What are the key properties of (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid?
(3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid has a molecular weight of 589.64 g/mol, XLogP of 4.32, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1-benzyl-3-methylpiperidin-4-one;2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid is sourced from PubChem (CID 170172706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).