C18H21F2N3O4S — CID 170173051
[1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-(2-methylsulfanylethyl)carbamic acid (PubChem CID 170173051) has the molecular formula C18H21F2N3O4S and a molecular weight of 413.45 g/mol. Its IUPAC name is [1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-(2-methylsulfanylethyl)carbamic acid.
| Compound Name | [1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-(2-methylsulfanylethyl)carbamic acid |
|---|---|
| PubChem CID | 170173051 |
| Molecular Formula | C18H21F2N3O4S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | [1-[4-(2,6-dioxopiperidin-3-yl)-3,5-difluorophenyl]azetidin-3-yl]-(2-methylsulfanylethyl)carbamic acid |
| SMILES | CSCCN(C(=O)O)C1CN(c2cc(F)c(C3CCC(=O)NC3=O)c(F)c2)C1 |
| InChI | InChI=1S/C18H21F2N3O4S/c1-28-5-4-23(18(26)27)11-8-22(9-11)10-6-13(19)16(14(20)7-10)12-2-3-15(24)21-17(12)25/h6-7,11-12H,2-5,8-9H2,1H3,(H,26,27)(H,21,24,25) |
| InChIKey | LWAHUPDBUBUHBQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|