About [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate
[(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate (PubChem CID 170173099) has the molecular formula C15H24FNO2
and a molecular weight of 269.36 g/mol. Its IUPAC name is [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate |
| PubChem CID | 170173099 |
| Molecular Formula | C15H24FNO2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate |
| SMILES | CC1CC(=NOC(=O)C2(F)CCCCC2)CC(C)C1 |
| InChI | InChI=1S/C15H24FNO2/c1-11-8-12(2)10-13(9-11)17-19-14(18)15(16)6-4-3-5-7-15/h11-12H,3-10H2,1-2H3 |
| InChIKey | ZGJXTRWDCMQXEL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate?
The IUPAC name of [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate (CID 170173099) is [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate.
What is the SMILES notation for [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate?
The canonical SMILES for [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate is CC1CC(=NOC(=O)C2(F)CCCCC2)CC(C)C1.
What is the InChIKey of [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate?
The InChIKey is ZGJXTRWDCMQXEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24FNO2/c1-11-8-12(2)10-13(9-11)17-19-14(18)15(16)6-4-3-5-7-15/h11-12H,3-10H2,1-2H3.
What are the key properties of [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate?
[(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate has a molecular weight of 269.36 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3,5-dimethylcyclohexylidene)amino] 1-fluorocyclohexane-1-carboxylate is sourced from PubChem (CID 170173099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).