About N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine
N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 17017316) has the molecular formula C22H23N5
and a molecular weight of 357.46 g/mol. Its IUPAC name is N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine |
| PubChem CID | 17017316 |
| Molecular Formula | C22H23N5 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | CCN(Cc1ccccc1)c1ncnc2c1cnn2-c1cc(C)ccc1C |
| InChI | InChI=1S/C22H23N5/c1-4-26(14-18-8-6-5-7-9-18)21-19-13-25-27(22(19)24-15-23-21)20-12-16(2)10-11-17(20)3/h5-13,15H,4,14H2,1-3H3 |
| InChIKey | WJXHRTHKUZIPCF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine?
The IUPAC name of N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine (CID 17017316) is N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine.
What is the SMILES notation for N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine?
The canonical SMILES for N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine is CCN(Cc1ccccc1)c1ncnc2c1cnn2-c1cc(C)ccc1C.
What is the InChIKey of N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine?
The InChIKey is WJXHRTHKUZIPCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5/c1-4-26(14-18-8-6-5-7-9-18)21-19-13-25-27(22(19)24-15-23-21)20-12-16(2)10-11-17(20)3/h5-13,15H,4,14H2,1-3H3.
What are the key properties of N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine?
N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine has a molecular weight of 357.46 g/mol, XLogP of 4.46, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-(2,5-dimethylphenyl)-N-ethylpyrazolo[5,4-d]pyrimidin-4-amine is sourced from PubChem (CID 17017316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).