C22H22ClNO4S — CID 170173316
2-(2-chlorophenyl)-2-[2-[(2E,4E)-hexa-2,4-dienoyl]oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoic acid (PubChem CID 170173316) has the molecular formula C22H22ClNO4S and a molecular weight of 431.94 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-2-[2-[(2E,4E)-hexa-2,4-dienoyl]oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoic acid.
| Compound Name | 2-(2-chlorophenyl)-2-[2-[(2E,4E)-hexa-2,4-dienoyl]oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoic acid |
|---|---|
| PubChem CID | 170173316 |
| Molecular Formula | C22H22ClNO4S |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-(2-chlorophenyl)-2-[2-[(2E,4E)-hexa-2,4-dienoyl]oxy-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]propanoic acid |
| SMILES | C/C=C/C=C/C(=O)Oc1cc2c(s1)CCN(C(C)(C(=O)O)c1ccccc1Cl)C2 |
| InChI | InChI=1S/C22H22ClNO4S/c1-3-4-5-10-19(25)28-20-13-15-14-24(12-11-18(15)29-20)22(2,21(26)27)16-8-6-7-9-17(16)23/h3-10,13H,11-12,14H2,1-2H3,(H,26,27)/b4-3+,10-5+ |
| InChIKey | DRKQAKMABLSBNL-COBAKMAKSA-N |
| XLogP | 4.80 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|