C34H51NO3 — CID 170173679
phenyl 2-[[(4R)-4-[(6S,8S,9S,10S,13R,17R)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetate (PubChem CID 170173679) has the molecular formula C34H51NO3 and a molecular weight of 521.79 g/mol. Its IUPAC name is phenyl 2-[[(4R)-4-[(6S,8S,9S,10S,13R,17R)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetate.
| Compound Name | phenyl 2-[[(4R)-4-[(6S,8S,9S,10S,13R,17R)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetate |
|---|---|
| PubChem CID | 170173679 |
| Molecular Formula | C34H51NO3 |
| Molecular Weight | 521.79 g/mol |
| Exact Mass | 521.39 |
| IUPAC Name | phenyl 2-[[(4R)-4-[(6S,8S,9S,10S,13R,17R)-6-ethyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]amino]acetate |
| SMILES | CC[C@H]1C[C@H]2C3CC[C@H]([C@H](C)CCC(=O)NCC(=O)Oc4ccccc4)[C@@]3(C)CC[C@@H]2[C@@]2(C)CCCCC12 |
| InChI | InChI=1S/C34H51NO3/c1-5-24-21-26-29-16-15-27(34(29,4)20-18-30(26)33(3)19-10-9-13-28(24)33)23(2)14-17-31(36)35-22-32(37)38-25-11-7-6-8-12-25/h6-8,11-12,23-24,26-30H,5,9-10,13-22H2,1-4H3,(H,35,36)/t23-,24+,26+,27-,28?,29?,30+,33+,34-/m1/s1 |
| InChIKey | HMQDUHHGBILJIB-SBZQVBKMSA-N |
| XLogP | 7.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.79 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|