C27H18F2N2O2P2S — CID 170174413
2-[[2-[2,6-difluoro-3-methyl-4,5-bis(phosphanyl)phenyl]-1-methylthieno[2,3-d]imidazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione (PubChem CID 170174413) has the molecular formula C27H18F2N2O2P2S and a molecular weight of 534.46 g/mol. Its IUPAC name is 2-[[2-[2,6-difluoro-3-methyl-4,5-bis(phosphanyl)phenyl]-1-methylthieno[2,3-d]imidazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione.
| Compound Name | 2-[[2-[2,6-difluoro-3-methyl-4,5-bis(phosphanyl)phenyl]-1-methylthieno[2,3-d]imidazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
|---|---|
| PubChem CID | 170174413 |
| Molecular Formula | C27H18F2N2O2P2S |
| Molecular Weight | 534.46 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | 2-[[2-[2,6-difluoro-3-methyl-4,5-bis(phosphanyl)phenyl]-1-methylthieno[2,3-d]imidazol-5-yl]methylidene]cyclopenta[b]naphthalene-1,3-dione |
| SMILES | Cc1c(F)c(-c2nc3sc(C=C4C(=O)c5cc6ccccc6cc5C4=O)cc3n2C)c(F)c(P)c1P |
| InChI | InChI=1S/C27H18F2N2O2P2S/c1-11-20(28)19(21(29)25(35)24(11)34)26-30-27-18(31(26)2)10-14(36-27)9-17-22(32)15-7-12-5-3-4-6-13(12)8-16(15)23(17)33/h3-10H,34-35H2,1-2H3 |
| InChIKey | VIDCYCRHXXLKKR-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.46 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|