C23H13F3NO2PS — CID 170174797
(2E)-4,5,7-trifluoro-2-[(4-methyl-5-phenylthieno[3,2-b]pyrrol-2-yl)methylidene]-6-phosphanylindene-1,3-dione (PubChem CID 170174797) has the molecular formula C23H13F3NO2PS and a molecular weight of 455.40 g/mol. Its IUPAC name is (2E)-4,5,7-trifluoro-2-[(4-methyl-5-phenylthieno[3,2-b]pyrrol-2-yl)methylidene]-6-phosphanylindene-1,3-dione.
| Compound Name | (2E)-4,5,7-trifluoro-2-[(4-methyl-5-phenylthieno[3,2-b]pyrrol-2-yl)methylidene]-6-phosphanylindene-1,3-dione |
|---|---|
| PubChem CID | 170174797 |
| Molecular Formula | C23H13F3NO2PS |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | (2E)-4,5,7-trifluoro-2-[(4-methyl-5-phenylthieno[3,2-b]pyrrol-2-yl)methylidene]-6-phosphanylindene-1,3-dione |
| SMILES | Cn1c(-c2ccccc2)cc2sc(/C=C3\C(=O)c4c(F)c(F)c(P)c(F)c4C3=O)cc21 |
| InChI | InChI=1S/C23H13F3NO2PS/c1-27-13(10-5-3-2-4-6-10)9-15-14(27)8-11(31-15)7-12-21(28)16-17(22(12)29)19(25)23(30)20(26)18(16)24/h2-9H,30H2,1H3/b12-7+ |
| InChIKey | DHQMLYBRCXKNFS-KPKJPENVSA-N |
| XLogP | 5.29 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_one_A(55)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|