C23H10N4O2S — CID 170175057
2-[(2Z)-3-oxo-2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile (PubChem CID 170175057) has the molecular formula C23H10N4O2S and a molecular weight of 406.43 g/mol. Its IUPAC name is 2-[(2Z)-3-oxo-2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile.
| Compound Name | 2-[(2Z)-3-oxo-2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 170175057 |
| Molecular Formula | C23H10N4O2S |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 2-[(2Z)-3-oxo-2-[(5-phenyl-[1,3]thiazolo[5,4-d][1,3]oxazol-2-yl)methylidene]inden-1-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1/C(=C/c2nc3sc(-c4ccccc4)nc3o2)C(=O)c2ccccc21 |
| InChI | InChI=1S/C23H10N4O2S/c24-11-14(12-25)19-15-8-4-5-9-16(15)20(28)17(19)10-18-26-23-21(29-18)27-22(30-23)13-6-2-1-3-7-13/h1-10H/b17-10- |
| InChIKey | QKWSKRNDNJKBKZ-YVLHZVERSA-N |
| XLogP | 5.03 |
| TPSA | 103.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|